About (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide
(2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide (PubChem CID 91021348) has the molecular formula C8H11FN2
and a molecular weight of 154.19 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide.
Molecular Properties
| Compound Name | (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide |
| PubChem CID | 91021348 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide |
| SMILES | [H]/N=C(N)/C(/C=C(/F)C=C)=C/C |
| InChI | InChI=1S/C8H11FN2/c1-3-6(8(10)11)5-7(9)4-2/h3-5H,2H2,1H3,(H3,10,11)/b6-3+,7-5+ |
| InChIKey | JWHASJIGQOVJPD-SNCPXTGUSA-N |
| XLogP | 1.91 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide?
The IUPAC name of (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide (CID 91021348) is (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide.
What is the SMILES notation for (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide?
The canonical SMILES for (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide is [H]/N=C(N)/C(/C=C(/F)C=C)=C/C.
What is the InChIKey of (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide?
The InChIKey is JWHASJIGQOVJPD-SNCPXTGUSA-N. The full InChI is InChI=1S/C8H11FN2/c1-3-6(8(10)11)5-7(9)4-2/h3-5H,2H2,1H3,(H3,10,11)/b6-3+,7-5+.
What are the key properties of (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide?
(2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide has a molecular weight of 154.19 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-2-ethylidene-4-fluorohexa-3,5-dienimidamide is sourced from PubChem (CID 91021348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).