About N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine
N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine (PubChem CID 91021615) has the molecular formula C14H32N4
and a molecular weight of 256.44 g/mol. Its IUPAC name is N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine |
| PubChem CID | 91021615 |
| Molecular Formula | C14H32N4 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine |
| SMILES | CCNCCCNCCCNCCCN=C(C)C |
| InChI | InChI=1S/C14H32N4/c1-4-15-8-5-9-16-10-6-11-17-12-7-13-18-14(2)3/h15-17H,4-13H2,1-3H3 |
| InChIKey | IMLYPHRWYAZQAY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine?
The IUPAC name of N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine (CID 91021615) is N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine.
What is the SMILES notation for N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine?
The canonical SMILES for N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine is CCNCCCNCCCNCCCN=C(C)C.
What is the InChIKey of N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine?
The InChIKey is IMLYPHRWYAZQAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N4/c1-4-15-8-5-9-16-10-6-11-17-12-7-13-18-14(2)3/h15-17H,4-13H2,1-3H3.
What are the key properties of N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine?
N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine has a molecular weight of 256.44 g/mol, XLogP of 1.43, 13 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-[3-[3-(propan-2-ylideneamino)propylamino]propyl]propane-1,3-diamine is sourced from PubChem (CID 91021615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).