C15H18O — CID 91021904
6,6-dimethyl-1,6a,10a,10b-tetrahydrobenzo[c]chromene (PubChem CID 91021904) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 6,6-dimethyl-1,6a,10a,10b-tetrahydrobenzo[c]chromene.
| Compound Name | 6,6-dimethyl-1,6a,10a,10b-tetrahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 91021904 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 6,6-dimethyl-1,6a,10a,10b-tetrahydrobenzo[c]chromene |
| SMILES | CC1(C)OC2=CC=CCC2C2C=CC=CC21 |
| InChI | InChI=1S/C15H18O/c1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)16-15/h3-7,9-13H,8H2,1-2H3 |
| InChIKey | QEUHNFOOGZZVQO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |