C24H21FN4O3 — CID 91021989
3-[2-(6-fluoro-3-pyridinyl)ethenyl]-N-[(1S)-2-hydroxy-1-phenylethyl]-4-methoxy-1H-indazole-5-carboxamide (PubChem CID 91021989) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is 3-[2-(6-fluoro-3-pyridinyl)ethenyl]-N-[(1S)-2-hydroxy-1-phenylethyl]-4-methoxy-1H-indazole-5-carboxamide.
| Compound Name | 3-[2-(6-fluoro-3-pyridinyl)ethenyl]-N-[(1S)-2-hydroxy-1-phenylethyl]-4-methoxy-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91021989 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 3-[2-(6-fluoro-3-pyridinyl)ethenyl]-N-[(1S)-2-hydroxy-1-phenylethyl]-4-methoxy-1H-indazole-5-carboxamide |
| SMILES | COc1c(C(=O)N[C@H](CO)c2ccccc2)ccc2[nH]nc(C=Cc3ccc(F)nc3)c12 |
| InChI | InChI=1S/C24H21FN4O3/c1-32-23-17(24(31)27-20(14-30)16-5-3-2-4-6-16)9-11-19-22(23)18(28-29-19)10-7-15-8-12-21(25)26-13-15/h2-13,20,30H,14H2,1H3,(H,27,31)(H,28,29)/t20-/m1/s1 |
| InChIKey | SPQOJLOPIFWGLY-HXUWFJFHSA-N |
| XLogP | 3.74 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|