C22H33NO6S2 — CID 91022130
[methyl(propan-2-yl)amino]methyl 4-methylbenzenesulfonate;propyl 4-methylbenzenesulfonate (PubChem CID 91022130) has the molecular formula C22H33NO6S2 and a molecular weight of 471.64 g/mol. Its IUPAC name is [methyl(propan-2-yl)amino]methyl 4-methylbenzenesulfonate;propyl 4-methylbenzenesulfonate.
| Compound Name | [methyl(propan-2-yl)amino]methyl 4-methylbenzenesulfonate;propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91022130 |
| Molecular Formula | C22H33NO6S2 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [methyl(propan-2-yl)amino]methyl 4-methylbenzenesulfonate;propyl 4-methylbenzenesulfonate |
| SMILES | CCCOS(=O)(=O)c1ccc(C)cc1.Cc1ccc(S(=O)(=O)OCN(C)C(C)C)cc1 |
| InChI | InChI=1S/C12H19NO3S.C10H14O3S/c1-10(2)13(4)9-16-17(14,15)12-7-5-11(3)6-8-12;1-3-8-13-14(11,12)10-6-4-9(2)5-7-10/h5-8,10H,9H2,1-4H3;4-7H,3,8H2,1-2H3 |
| InChIKey | OBRUTJGQJZYADW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|