About N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid
N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid (PubChem CID 91022274) has the molecular formula C8H17N2O6S2-
and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid |
| PubChem CID | 91022274 |
| Molecular Formula | C8H17N2O6S2- |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid |
| SMILES | CNC(=O)/C=C\C(=O)O.CS(C)([O-])NS(C)(=O)=O |
| InChI | InChI=1S/C5H7NO3.C3H11NO3S2/c1-6-4(7)2-3-5(8)9;1-8(2,5)4-9(3,6)7/h2-3H,1H3,(H,6,7)(H,8,9);4-5H,1-3H3/p-1/b3-2-; |
| InChIKey | WFJOHILSHHSHTA-OLGQORCHSA-M |
| XLogP | -0.98 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid?
The IUPAC name of N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid (CID 91022274) is N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid.
What is the SMILES notation for N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid?
The canonical SMILES for N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid is CNC(=O)/C=C\C(=O)O.CS(C)([O-])NS(C)(=O)=O.
What is the InChIKey of N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid?
The InChIKey is WFJOHILSHHSHTA-OLGQORCHSA-M. The full InChI is InChI=1S/C5H7NO3.C3H11NO3S2/c1-6-4(7)2-3-5(8)9;1-8(2,5)4-9(3,6)7/h2-3H,1H3,(H,6,7)(H,8,9);4-5H,1-3H3/p-1/b3-2-;.
What are the key properties of N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid?
N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid has a molecular weight of 301.37 g/mol, XLogP of -0.98, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dimethyl(oxido)-λ4-sulfanyl]methanesulfonamide;(Z)-4-(methylamino)-4-oxobut-2-enoic acid is sourced from PubChem (CID 91022274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).