About 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one
4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one (PubChem CID 91022415) has the molecular formula C4H5ClN2O2
and a molecular weight of 148.55 g/mol. Its IUPAC name is 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one |
| PubChem CID | 91022415 |
| Molecular Formula | C4H5ClN2O2 |
| Molecular Weight | 148.55 g/mol |
| Exact Mass | 148.00 |
| IUPAC Name | 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]cc(C(O)Cl)[nH]1 |
| InChI | InChI=1S/C4H5ClN2O2/c5-3(8)2-1-6-4(9)7-2/h1,3,8H,(H2,6,7,9) |
| InChIKey | XPDAMBGACHKMLM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.55 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one?
The IUPAC name of 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one (CID 91022415) is 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one.
What is the SMILES notation for 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one?
The canonical SMILES for 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one is O=c1[nH]cc(C(O)Cl)[nH]1.
What is the InChIKey of 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one?
The InChIKey is XPDAMBGACHKMLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2O2/c5-3(8)2-1-6-4(9)7-2/h1,3,8H,(H2,6,7,9).
What are the key properties of 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one?
4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one has a molecular weight of 148.55 g/mol, XLogP of -0.07, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[chloro(hydroxy)methyl]-1,3-dihydroimidazol-2-one is sourced from PubChem (CID 91022415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).