C25H29F4N7O — CID 91022492
N-[5-fluoro-6-(5-methyl-1,2,4-triazol-1-yl)hepta-2,4,6-trien-3-yl]-1-[5-[4-(trifluoromethoxy)phenyl]pentyl]-2H-1,3,5-triazin-4-amine (PubChem CID 91022492) has the molecular formula C25H29F4N7O and a molecular weight of 519.55 g/mol. Its IUPAC name is N-[5-fluoro-6-(5-methyl-1,2,4-triazol-1-yl)hepta-2,4,6-trien-3-yl]-1-[5-[4-(trifluoromethoxy)phenyl]pentyl]-2H-1,3,5-triazin-4-amine.
| Compound Name | N-[5-fluoro-6-(5-methyl-1,2,4-triazol-1-yl)hepta-2,4,6-trien-3-yl]-1-[5-[4-(trifluoromethoxy)phenyl]pentyl]-2H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 91022492 |
| Molecular Formula | C25H29F4N7O |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | N-[5-fluoro-6-(5-methyl-1,2,4-triazol-1-yl)hepta-2,4,6-trien-3-yl]-1-[5-[4-(trifluoromethoxy)phenyl]pentyl]-2H-1,3,5-triazin-4-amine |
| SMILES | C=C(C(F)=CC(=CC)NC1=NCN(CCCCCc2ccc(OC(F)(F)F)cc2)C=N1)n1ncnc1C |
| InChI | InChI=1S/C25H29F4N7O/c1-4-21(14-23(26)18(2)36-19(3)30-15-33-36)34-24-31-16-35(17-32-24)13-7-5-6-8-20-9-11-22(12-10-20)37-25(27,28)29/h4,9-12,14-16H,2,5-8,13,17H2,1,3H3,(H,32,34) |
| InChIKey | XJKIAHMTOVUMFO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|