C23H23F3N4O5 — CID 91022559
1-[(4-imino-2-oxopentanoyl)amino]-N-[[5-[4-methoxy-2-(trifluoromethyl)phenoxy]-2-pyridinyl]methyl]cyclopropane-1-carboxamide (PubChem CID 91022559) has the molecular formula C23H23F3N4O5 and a molecular weight of 492.45 g/mol. Its IUPAC name is 1-[(4-imino-2-oxopentanoyl)amino]-N-[[5-[4-methoxy-2-(trifluoromethyl)phenoxy]-2-pyridinyl]methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[(4-imino-2-oxopentanoyl)amino]-N-[[5-[4-methoxy-2-(trifluoromethyl)phenoxy]-2-pyridinyl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91022559 |
| Molecular Formula | C23H23F3N4O5 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 1-[(4-imino-2-oxopentanoyl)amino]-N-[[5-[4-methoxy-2-(trifluoromethyl)phenoxy]-2-pyridinyl]methyl]cyclopropane-1-carboxamide |
| SMILES | [H]/N=C(\C)CC(=O)C(=O)NC1(C(=O)NCc2ccc(Oc3ccc(OC)cc3C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C23H23F3N4O5/c1-13(27)9-18(31)20(32)30-22(7-8-22)21(33)29-11-14-3-4-16(12-28-14)35-19-6-5-15(34-2)10-17(19)23(24,25)26/h3-6,10,12,27H,7-9,11H2,1-2H3,(H,29,33)(H,30,32)/b27-13+ |
| InChIKey | GVPKHFQFDSQETI-UVHMKAGCSA-N |
| XLogP | 3.17 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|