About 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile
2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile (PubChem CID 91022798) has the molecular formula C9H12F3NS2
and a molecular weight of 255.33 g/mol. Its IUPAC name is 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile |
| PubChem CID | 91022798 |
| Molecular Formula | C9H12F3NS2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile |
| SMILES | N#CC(SCCC(F)(F)F)C1CCSC1 |
| InChI | InChI=1S/C9H12F3NS2/c10-9(11,12)2-4-15-8(5-13)7-1-3-14-6-7/h7-8H,1-4,6H2 |
| InChIKey | OMFLPPKXUNDVTG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile?
The IUPAC name of 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile (CID 91022798) is 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile.
What is the SMILES notation for 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile?
The canonical SMILES for 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile is N#CC(SCCC(F)(F)F)C1CCSC1.
What is the InChIKey of 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile?
The InChIKey is OMFLPPKXUNDVTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3NS2/c10-9(11,12)2-4-15-8(5-13)7-1-3-14-6-7/h7-8H,1-4,6H2.
What are the key properties of 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile?
2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile has a molecular weight of 255.33 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thiolan-3-yl)-2-(3,3,3-trifluoropropylsulfanyl)acetonitrile is sourced from PubChem (CID 91022798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).