About 1H-benzo[c][1]benzofuran
1H-benzo[c][1]benzofuran (PubChem CID 91023391) has the molecular formula C12H10O
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1H-benzo[c][1]benzofuran.
Molecular Properties
| Compound Name | 1H-benzo[c][1]benzofuran |
| PubChem CID | 91023391 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1H-benzo[c][1]benzofuran |
| SMILES | C1=CCC23C=CC=CC2=COC3=C1 |
| InChI | InChI=1S/C12H10O/c1-3-7-12-8-4-2-6-11(12)13-9-10(12)5-1/h1-7,9H,8H2 |
| InChIKey | YFWKUVOCVJLJNL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-benzo[c][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzo[c][1]benzofuran?
The IUPAC name of 1H-benzo[c][1]benzofuran (CID 91023391) is 1H-benzo[c][1]benzofuran.
What is the SMILES notation for 1H-benzo[c][1]benzofuran?
The canonical SMILES for 1H-benzo[c][1]benzofuran is C1=CCC23C=CC=CC2=COC3=C1.
What is the InChIKey of 1H-benzo[c][1]benzofuran?
The InChIKey is YFWKUVOCVJLJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O/c1-3-7-12-8-4-2-6-11(12)13-9-10(12)5-1/h1-7,9H,8H2.
What are the key properties of 1H-benzo[c][1]benzofuran?
1H-benzo[c][1]benzofuran has a molecular weight of 170.21 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzo[c][1]benzofuran is sourced from PubChem (CID 91023391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).