About 2,5-difluorobenzene-1,4-disulfinic acid
2,5-difluorobenzene-1,4-disulfinic acid (PubChem CID 91023556) has the molecular formula C6H4F2O4S2
and a molecular weight of 242.22 g/mol. Its IUPAC name is 2,5-difluorobenzene-1,4-disulfinic acid.
Molecular Properties
| Compound Name | 2,5-difluorobenzene-1,4-disulfinic acid |
| PubChem CID | 91023556 |
| Molecular Formula | C6H4F2O4S2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 241.95 |
| IUPAC Name | 2,5-difluorobenzene-1,4-disulfinic acid |
| SMILES | O=S(O)c1cc(F)c(S(=O)O)cc1F |
| InChI | InChI=1S/C6H4F2O4S2/c7-3-1-5(13(9)10)4(8)2-6(3)14(11)12/h1-2H,(H,9,10)(H,11,12) |
| InChIKey | LZWVZNRYYZJEGA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2,5-difluorobenzene-1,4-disulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluorobenzene-1,4-disulfinic acid?
The IUPAC name of 2,5-difluorobenzene-1,4-disulfinic acid (CID 91023556) is 2,5-difluorobenzene-1,4-disulfinic acid.
What is the SMILES notation for 2,5-difluorobenzene-1,4-disulfinic acid?
The canonical SMILES for 2,5-difluorobenzene-1,4-disulfinic acid is O=S(O)c1cc(F)c(S(=O)O)cc1F.
What is the InChIKey of 2,5-difluorobenzene-1,4-disulfinic acid?
The InChIKey is LZWVZNRYYZJEGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2O4S2/c7-3-1-5(13(9)10)4(8)2-6(3)14(11)12/h1-2H,(H,9,10)(H,11,12).
What are the key properties of 2,5-difluorobenzene-1,4-disulfinic acid?
2,5-difluorobenzene-1,4-disulfinic acid has a molecular weight of 242.22 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluorobenzene-1,4-disulfinic acid is sourced from PubChem (CID 91023556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).