4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid

C9H12O2 — CID 91023883

IUPAC4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid
SMILESCC1=C(C)CC(C(=O)O)C=C1
InChIInChI=1S/C9H12O2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-4,8H,5H2,1-2H3,(H,10,11)
InChIKeyDXBHQFQGRPRWAA-UHFFFAOYSA-N
MW152.19 g/mol
LogP1.98
Rot. Bonds1

About 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid

4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 91023883) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid
PubChem CID91023883
Molecular FormulaC9H12O2
Molecular Weight152.19 g/mol
Exact Mass152.08
IUPAC Name4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid
SMILESCC1=C(C)CC(C(=O)O)C=C1
InChIInChI=1S/C9H12O2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-4,8H,5H2,1-2H3,(H,10,11)
InChIKeyDXBHQFQGRPRWAA-UHFFFAOYSA-N
XLogP1.98
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.19
LogP ≤ 51.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid (CID 91023883) is 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid is CC1=C(C)CC(C(=O)O)C=C1.
What is the InChIKey of 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is DXBHQFQGRPRWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-4,8H,5H2,1-2H3,(H,10,11).
What are the key properties of 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 152.19 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 91023883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).