About 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid
4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 91023883) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 91023883 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC1=C(C)CC(C(=O)O)C=C1 |
| InChI | InChI=1S/C9H12O2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-4,8H,5H2,1-2H3,(H,10,11) |
| InChIKey | DXBHQFQGRPRWAA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid (CID 91023883) is 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid is CC1=C(C)CC(C(=O)O)C=C1.
What is the InChIKey of 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is DXBHQFQGRPRWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-6-3-4-8(9(10)11)5-7(6)2/h3-4,8H,5H2,1-2H3,(H,10,11).
What are the key properties of 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid?
4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 152.19 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 91023883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).