About but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione
but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 91024095) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
Molecular Properties
| Compound Name | but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| PubChem CID | 91024095 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=CCC.O=C1CC(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C10H10O2.C4H8/c11-7-4-8(12)10-6-2-1-5(3-6)9(7)10;1-3-4-2/h1-2,5-6,9-10H,3-4H2;3H,1,4H2,2H3 |
| InChIKey | FFXGVJFXBSPAJX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
The IUPAC name of but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CID 91024095) is but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
What is the SMILES notation for but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
The canonical SMILES for but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione is C=CCC.O=C1CC(=O)C2C3C=CC(C3)C12.
What is the InChIKey of but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
The InChIKey is FFXGVJFXBSPAJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C4H8/c11-7-4-8(12)10-6-2-1-5(3-6)9(7)10;1-3-4-2/h1-2,5-6,9-10H,3-4H2;3H,1,4H2,2H3.
What are the key properties of but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione?
but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione has a molecular weight of 218.30 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;tricyclo[5.2.1.02,6]dec-8-ene-3,5-dione is sourced from PubChem (CID 91024095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).