About 4,7a-dihydrothiopyrano[4,3-b]pyrrole
4,7a-dihydrothiopyrano[4,3-b]pyrrole (PubChem CID 91024144) has the molecular formula C7H7NS
and a molecular weight of 137.21 g/mol. Its IUPAC name is 4,7a-dihydrothiopyrano[4,3-b]pyrrole.
Molecular Properties
| Compound Name | 4,7a-dihydrothiopyrano[4,3-b]pyrrole |
| PubChem CID | 91024144 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 4,7a-dihydrothiopyrano[4,3-b]pyrrole |
| SMILES | C1=CC2N=CC=C2CS1 |
| InChI | InChI=1S/C7H7NS/c1-3-8-7-2-4-9-5-6(1)7/h1-4,7H,5H2 |
| InChIKey | WUQRNQNPLUULFR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,7a-dihydrothiopyrano[4,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7a-dihydrothiopyrano[4,3-b]pyrrole?
The IUPAC name of 4,7a-dihydrothiopyrano[4,3-b]pyrrole (CID 91024144) is 4,7a-dihydrothiopyrano[4,3-b]pyrrole.
What is the SMILES notation for 4,7a-dihydrothiopyrano[4,3-b]pyrrole?
The canonical SMILES for 4,7a-dihydrothiopyrano[4,3-b]pyrrole is C1=CC2N=CC=C2CS1.
What is the InChIKey of 4,7a-dihydrothiopyrano[4,3-b]pyrrole?
The InChIKey is WUQRNQNPLUULFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS/c1-3-8-7-2-4-9-5-6(1)7/h1-4,7H,5H2.
What are the key properties of 4,7a-dihydrothiopyrano[4,3-b]pyrrole?
4,7a-dihydrothiopyrano[4,3-b]pyrrole has a molecular weight of 137.21 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7a-dihydrothiopyrano[4,3-b]pyrrole is sourced from PubChem (CID 91024144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).