C24H32O — CID 91024593
5-ethyl-6,12,13,18-tetramethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10,12,14-tetraene (PubChem CID 91024593) has the molecular formula C24H32O and a molecular weight of 336.52 g/mol. Its IUPAC name is 5-ethyl-6,12,13,18-tetramethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10,12,14-tetraene.
| Compound Name | 5-ethyl-6,12,13,18-tetramethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10,12,14-tetraene |
|---|---|
| PubChem CID | 91024593 |
| Molecular Formula | C24H32O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 5-ethyl-6,12,13,18-tetramethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10,12,14-tetraene |
| SMILES | CCC1CCC2C1(C)CC=C1C=C3C(C)=C(C)C=CC34CC(C)C12O4 |
| InChI | InChI=1S/C24H32O/c1-6-18-7-8-21-22(18,5)11-10-19-13-20-17(4)15(2)9-12-23(20)14-16(3)24(19,21)25-23/h9-10,12-13,16,18,21H,6-8,11,14H2,1-5H3 |
| InChIKey | JMJCLMSAZNHILZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |