C21H23NO4 — CID 9102469
(E)-N-(4-ethoxy-3-methoxyphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-enamide (PubChem CID 9102469) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (E)-N-(4-ethoxy-3-methoxyphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-ethoxy-3-methoxyphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9102469 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (E)-N-(4-ethoxy-3-methoxyphenyl)-3-(4-prop-2-enoxyphenyl)prop-2-enamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)Nc2ccc(OCC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-4-14-26-18-10-6-16(7-11-18)8-13-21(23)22-17-9-12-19(25-5-2)20(15-17)24-3/h4,6-13,15H,1,5,14H2,2-3H3,(H,22,23)/b13-8+ |
| InChIKey | IUZDFRKILIVFCM-MDWZMJQESA-N |
| XLogP | 4.31 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|