C23H30FN3S — CID 91024692
1-(2-tert-butylsulfanyliminoethyl)-N-(4-fluorophenyl)-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-imine (PubChem CID 91024692) has the molecular formula C23H30FN3S and a molecular weight of 399.58 g/mol. Its IUPAC name is 1-(2-tert-butylsulfanyliminoethyl)-N-(4-fluorophenyl)-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-imine.
| Compound Name | 1-(2-tert-butylsulfanyliminoethyl)-N-(4-fluorophenyl)-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-imine |
|---|---|
| PubChem CID | 91024692 |
| Molecular Formula | C23H30FN3S |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 1-(2-tert-butylsulfanyliminoethyl)-N-(4-fluorophenyl)-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-imine |
| SMILES | [H]/N=C/C1CC2(C)C(=C/C1=N\c1ccc(F)cc1)CCC2CC=NSC(C)(C)C |
| InChI | InChI=1S/C23H30FN3S/c1-22(2,3)28-26-12-11-17-5-6-18-13-21(16(15-25)14-23(17,18)4)27-20-9-7-19(24)8-10-20/h7-10,12-13,15-17,25H,5-6,11,14H2,1-4H3/b25-15+,26-12?,27-21+ |
| InChIKey | OMFUYWOVEPUJIM-MHIAXISCSA-N |
| XLogP | 6.82 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|