C9H22NO7P2+ — CID 91025102
trihydroxy-[3-[methyl(pentyl)amino]-3-oxo-1-phosphonopropyl]phosphanium (PubChem CID 91025102) has the molecular formula C9H22NO7P2+ and a molecular weight of 318.22 g/mol. Its IUPAC name is trihydroxy-[3-[methyl(pentyl)amino]-3-oxo-1-phosphonopropyl]phosphanium.
| Compound Name | trihydroxy-[3-[methyl(pentyl)amino]-3-oxo-1-phosphonopropyl]phosphanium |
|---|---|
| PubChem CID | 91025102 |
| Molecular Formula | C9H22NO7P2+ |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | trihydroxy-[3-[methyl(pentyl)amino]-3-oxo-1-phosphonopropyl]phosphanium |
| SMILES | CCCCCN(C)C(=O)CC(P(=O)(O)O)[P+](O)(O)O |
| InChI | InChI=1S/C9H21NO7P2/c1-3-4-5-6-10(2)8(11)7-9(18(12,13)14)19(15,16)17/h9,12-14H,3-7H2,1-2H3,(H-,15,16,17)/p+1 |
| InChIKey | LORNIIJMALSASL-UHFFFAOYSA-O |
| XLogP | 0.27 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|