C20H23F2NO9S — CID 91025228
6-[2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetyl]oxyhexyl prop-2-enoate (PubChem CID 91025228) has the molecular formula C20H23F2NO9S and a molecular weight of 491.47 g/mol. Its IUPAC name is 6-[2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetyl]oxyhexyl prop-2-enoate.
| Compound Name | 6-[2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetyl]oxyhexyl prop-2-enoate |
|---|---|
| PubChem CID | 91025228 |
| Molecular Formula | C20H23F2NO9S |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 6-[2-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxysulfonyl]-2,2-difluoroacetyl]oxyhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)C(F)(F)S(=O)(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C20H23F2NO9S/c1-2-14(24)30-9-5-3-4-6-10-31-19(27)20(21,22)33(28,29)32-23-17(25)15-12-7-8-13(11-12)16(15)18(23)26/h2,7-8,12-13,25-26H,1,3-6,9-11H2 |
| InChIKey | AUTVNTFXUZQDNF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|