About methyl methanesulfonate;2-morpholin-4-ylchromen-4-one
methyl methanesulfonate;2-morpholin-4-ylchromen-4-one (PubChem CID 91025278) has the molecular formula C15H19NO6S
and a molecular weight of 341.38 g/mol. Its IUPAC name is methyl methanesulfonate;2-morpholin-4-ylchromen-4-one.
Molecular Properties
| Compound Name | methyl methanesulfonate;2-morpholin-4-ylchromen-4-one |
| PubChem CID | 91025278 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | methyl methanesulfonate;2-morpholin-4-ylchromen-4-one |
| SMILES | COS(C)(=O)=O.O=c1cc(N2CCOCC2)oc2ccccc12 |
| InChI | InChI=1S/C13H13NO3.C2H6O3S/c15-11-9-13(14-5-7-16-8-6-14)17-12-4-2-1-3-10(11)12;1-5-6(2,3)4/h1-4,9H,5-8H2;1-2H3 |
| InChIKey | YXGLPJYDEHBCJF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl methanesulfonate;2-morpholin-4-ylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl methanesulfonate;2-morpholin-4-ylchromen-4-one?
The IUPAC name of methyl methanesulfonate;2-morpholin-4-ylchromen-4-one (CID 91025278) is methyl methanesulfonate;2-morpholin-4-ylchromen-4-one.
What is the SMILES notation for methyl methanesulfonate;2-morpholin-4-ylchromen-4-one?
The canonical SMILES for methyl methanesulfonate;2-morpholin-4-ylchromen-4-one is COS(C)(=O)=O.O=c1cc(N2CCOCC2)oc2ccccc12.
What is the InChIKey of methyl methanesulfonate;2-morpholin-4-ylchromen-4-one?
The InChIKey is YXGLPJYDEHBCJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3.C2H6O3S/c15-11-9-13(14-5-7-16-8-6-14)17-12-4-2-1-3-10(11)12;1-5-6(2,3)4/h1-4,9H,5-8H2;1-2H3.
What are the key properties of methyl methanesulfonate;2-morpholin-4-ylchromen-4-one?
methyl methanesulfonate;2-morpholin-4-ylchromen-4-one has a molecular weight of 341.38 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl methanesulfonate;2-morpholin-4-ylchromen-4-one is sourced from PubChem (CID 91025278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).