C35H46N6O — CID 91025414
4-[bis[4-(2,4,4-trimethylpentan-2-yl)-2H-benzotriazol-5-yl]methyl]phenol (PubChem CID 91025414) has the molecular formula C35H46N6O and a molecular weight of 566.79 g/mol. Its IUPAC name is 4-[bis[4-(2,4,4-trimethylpentan-2-yl)-2H-benzotriazol-5-yl]methyl]phenol.
| Compound Name | 4-[bis[4-(2,4,4-trimethylpentan-2-yl)-2H-benzotriazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 91025414 |
| Molecular Formula | C35H46N6O |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.37 |
| IUPAC Name | 4-[bis[4-(2,4,4-trimethylpentan-2-yl)-2H-benzotriazol-5-yl]methyl]phenol |
| SMILES | CC(C)(C)CC(C)(C)c1c(C(c2ccc(O)cc2)c2ccc3n[nH]nc3c2C(C)(C)CC(C)(C)C)ccc2n[nH]nc12 |
| InChI | InChI=1S/C35H46N6O/c1-32(2,3)19-34(7,8)28-23(15-17-25-30(28)38-40-36-25)27(21-11-13-22(42)14-12-21)24-16-18-26-31(39-41-37-26)29(24)35(9,10)20-33(4,5)6/h11-18,27,42H,19-20H2,1-10H3,(H,36,38,40)(H,37,39,41) |
| InChIKey | PPKFLCAGIWFKDE-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|