C27H37F6NO5 — CID 91025442
1,1,1,3,3,3-hexafluoropropan-2-yl 7-cyano-9-ethyl-6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentoxy)-5-oxatricyclo[5.2.1.04,8]decane-10-carboxylate (PubChem CID 91025442) has the molecular formula C27H37F6NO5 and a molecular weight of 569.58 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 7-cyano-9-ethyl-6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentoxy)-5-oxatricyclo[5.2.1.04,8]decane-10-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 7-cyano-9-ethyl-6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentoxy)-5-oxatricyclo[5.2.1.04,8]decane-10-carboxylate |
|---|---|
| PubChem CID | 91025442 |
| Molecular Formula | C27H37F6NO5 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 7-cyano-9-ethyl-6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentoxy)-5-oxatricyclo[5.2.1.04,8]decane-10-carboxylate |
| SMILES | CCC1C2CC(OCC(C)(CC(C)(C)C)C(C)C)C3OC(=O)C(C#N)(C2C(=O)OC(C(F)(F)F)C(F)(F)F)C13 |
| InChI | InChI=1S/C27H37F6NO5/c1-8-14-15-9-16(37-12-24(7,13(2)3)10-23(4,5)6)19-17(14)25(11-34,22(36)38-19)18(15)20(35)39-21(26(28,29)30)27(31,32)33/h13-19,21H,8-10,12H2,1-7H3 |
| InChIKey | LCHRUDBOXZUIGU-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |