C24H47O3Si+ — CID 91025948
[(1R,2R,3R,4S)-3-[(Z)-hept-2-enyl]-4-hydroxy-2-[(E,3R)-3-hydroxydec-1-enyl]cyclopentyl]oxy-dimethylsilanylium (PubChem CID 91025948) has the molecular formula C24H47O3Si+ and a molecular weight of 411.72 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-3-[(Z)-hept-2-enyl]-4-hydroxy-2-[(E,3R)-3-hydroxydec-1-enyl]cyclopentyl]oxy-dimethylsilanylium.
| Compound Name | [(1R,2R,3R,4S)-3-[(Z)-hept-2-enyl]-4-hydroxy-2-[(E,3R)-3-hydroxydec-1-enyl]cyclopentyl]oxy-dimethylsilanylium |
|---|---|
| PubChem CID | 91025948 |
| Molecular Formula | C24H47O3Si+ |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.33 |
| IUPAC Name | [(1R,2R,3R,4S)-3-[(Z)-hept-2-enyl]-4-hydroxy-2-[(E,3R)-3-hydroxydec-1-enyl]cyclopentyl]oxy-dimethylsilanylium |
| SMILES | CCCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](O)CCCCCCC)[C@H](O[SiH2+](C)C)C[C@@H]1O |
| InChI | InChI=1S/C24H47O3Si/c1-5-7-9-11-13-15-20(25)17-18-22-21(16-14-12-10-8-6-2)23(26)19-24(22)27-28(3)4/h12,14,17-18,20-26H,5-11,13,15-16,19,28H2,1-4H3/q+1/b14-12-,18-17+/t20-,21-,22-,23+,24-/m1/s1 |
| InChIKey | ZSOXKUQZSFJGON-HIIOMMESSA-N |
| XLogP | 5.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|