About 3-amino-1-ethylpyrrole-2,5-diol
3-amino-1-ethylpyrrole-2,5-diol (PubChem CID 91025950) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 3-amino-1-ethylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-amino-1-ethylpyrrole-2,5-diol |
| PubChem CID | 91025950 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 3-amino-1-ethylpyrrole-2,5-diol |
| SMILES | CCn1c(O)cc(N)c1O |
| InChI | InChI=1S/C6H10N2O2/c1-2-8-5(9)3-4(7)6(8)10/h3,9-10H,2,7H2,1H3 |
| InChIKey | LVLOPUNRQHZCCP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-ethylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-ethylpyrrole-2,5-diol?
The IUPAC name of 3-amino-1-ethylpyrrole-2,5-diol (CID 91025950) is 3-amino-1-ethylpyrrole-2,5-diol.
What is the SMILES notation for 3-amino-1-ethylpyrrole-2,5-diol?
The canonical SMILES for 3-amino-1-ethylpyrrole-2,5-diol is CCn1c(O)cc(N)c1O.
What is the InChIKey of 3-amino-1-ethylpyrrole-2,5-diol?
The InChIKey is LVLOPUNRQHZCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-2-8-5(9)3-4(7)6(8)10/h3,9-10H,2,7H2,1H3.
What are the key properties of 3-amino-1-ethylpyrrole-2,5-diol?
3-amino-1-ethylpyrrole-2,5-diol has a molecular weight of 142.16 g/mol, XLogP of 0.50, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-ethylpyrrole-2,5-diol is sourced from PubChem (CID 91025950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).