About 2-amino-1-methyl-4,5-dihydroimidazol-4-ol
2-amino-1-methyl-4,5-dihydroimidazol-4-ol (PubChem CID 91026129) has the molecular formula C4H9N3O
and a molecular weight of 115.14 g/mol. Its IUPAC name is 2-amino-1-methyl-4,5-dihydroimidazol-4-ol.
Molecular Properties
| Compound Name | 2-amino-1-methyl-4,5-dihydroimidazol-4-ol |
| PubChem CID | 91026129 |
| Molecular Formula | C4H9N3O |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | 2-amino-1-methyl-4,5-dihydroimidazol-4-ol |
| SMILES | CN1CC(O)N=C1N |
| InChI | InChI=1S/C4H9N3O/c1-7-2-3(8)6-4(7)5/h3,8H,2H2,1H3,(H2,5,6) |
| InChIKey | YOESDXMOJRQPJM-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-methyl-4,5-dihydroimidazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-methyl-4,5-dihydroimidazol-4-ol?
The IUPAC name of 2-amino-1-methyl-4,5-dihydroimidazol-4-ol (CID 91026129) is 2-amino-1-methyl-4,5-dihydroimidazol-4-ol.
What is the SMILES notation for 2-amino-1-methyl-4,5-dihydroimidazol-4-ol?
The canonical SMILES for 2-amino-1-methyl-4,5-dihydroimidazol-4-ol is CN1CC(O)N=C1N.
What is the InChIKey of 2-amino-1-methyl-4,5-dihydroimidazol-4-ol?
The InChIKey is YOESDXMOJRQPJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O/c1-7-2-3(8)6-4(7)5/h3,8H,2H2,1H3,(H2,5,6).
What are the key properties of 2-amino-1-methyl-4,5-dihydroimidazol-4-ol?
2-amino-1-methyl-4,5-dihydroimidazol-4-ol has a molecular weight of 115.14 g/mol, XLogP of -1.44, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-methyl-4,5-dihydroimidazol-4-ol is sourced from PubChem (CID 91026129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).