About 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide
2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide (PubChem CID 91026529) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide.
Molecular Properties
| Compound Name | 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide |
| PubChem CID | 91026529 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide |
| SMILES | CC1=CC(C)=C(CC(N)C(N)=O)CC1 |
| InChI | InChI=1S/C11H18N2O/c1-7-3-4-9(8(2)5-7)6-10(12)11(13)14/h5,10H,3-4,6,12H2,1-2H3,(H2,13,14) |
| InChIKey | QPPVUEFDFGKVBZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide?
The IUPAC name of 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide (CID 91026529) is 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide.
What is the SMILES notation for 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide?
The canonical SMILES for 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide is CC1=CC(C)=C(CC(N)C(N)=O)CC1.
What is the InChIKey of 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide?
The InChIKey is QPPVUEFDFGKVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-7-3-4-9(8(2)5-7)6-10(12)11(13)14/h5,10H,3-4,6,12H2,1-2H3,(H2,13,14).
What are the key properties of 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide?
2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide has a molecular weight of 194.28 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,4-dimethylcyclohexa-1,3-dien-1-yl)propanamide is sourced from PubChem (CID 91026529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).