C20H24FN3O4S — CID 91026759
N-[(3-fluorophenyl)-piperidin-4-yl-sulfamoylmethyl]-2-methoxybenzamide (PubChem CID 91026759) has the molecular formula C20H24FN3O4S and a molecular weight of 421.49 g/mol. Its IUPAC name is N-[(3-fluorophenyl)-piperidin-4-yl-sulfamoylmethyl]-2-methoxybenzamide.
| Compound Name | N-[(3-fluorophenyl)-piperidin-4-yl-sulfamoylmethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 91026759 |
| Molecular Formula | C20H24FN3O4S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[(3-fluorophenyl)-piperidin-4-yl-sulfamoylmethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(c1cccc(F)c1)(C1CCNCC1)S(N)(=O)=O |
| InChI | InChI=1S/C20H24FN3O4S/c1-28-18-8-3-2-7-17(18)19(25)24-20(29(22,26)27,14-9-11-23-12-10-14)15-5-4-6-16(21)13-15/h2-8,13-14,23H,9-12H2,1H3,(H,24,25)(H2,22,26,27) |
| InChIKey | PSIQTYPSTAITOY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |