About 3-fluorobut-1-yne;fluoromethane
3-fluorobut-1-yne;fluoromethane (PubChem CID 91026864) has the molecular formula C5H8F2
and a molecular weight of 106.11 g/mol. Its IUPAC name is 3-fluorobut-1-yne;fluoromethane.
Molecular Properties
| Compound Name | 3-fluorobut-1-yne;fluoromethane |
| PubChem CID | 91026864 |
| Molecular Formula | C5H8F2 |
| Molecular Weight | 106.11 g/mol |
| Exact Mass | 106.06 |
| IUPAC Name | 3-fluorobut-1-yne;fluoromethane |
| SMILES | C#CC(C)F.CF |
| InChI | InChI=1S/C4H5F.CH3F/c1-3-4(2)5;1-2/h1,4H,2H3;1H3 |
| InChIKey | XGXBIEIYWWDDSQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.11 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluorobut-1-yne;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorobut-1-yne;fluoromethane?
The IUPAC name of 3-fluorobut-1-yne;fluoromethane (CID 91026864) is 3-fluorobut-1-yne;fluoromethane.
What is the SMILES notation for 3-fluorobut-1-yne;fluoromethane?
The canonical SMILES for 3-fluorobut-1-yne;fluoromethane is C#CC(C)F.CF.
What is the InChIKey of 3-fluorobut-1-yne;fluoromethane?
The InChIKey is XGXBIEIYWWDDSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F.CH3F/c1-3-4(2)5;1-2/h1,4H,2H3;1H3.
What are the key properties of 3-fluorobut-1-yne;fluoromethane?
3-fluorobut-1-yne;fluoromethane has a molecular weight of 106.11 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorobut-1-yne;fluoromethane is sourced from PubChem (CID 91026864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).