C10H16N2 — CID 91026933
N-methyl-N-(prop-2-enylideneamino)hexa-2,4-dien-2-amine (PubChem CID 91026933) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-methyl-N-(prop-2-enylideneamino)hexa-2,4-dien-2-amine.
| Compound Name | N-methyl-N-(prop-2-enylideneamino)hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 91026933 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-methyl-N-(prop-2-enylideneamino)hexa-2,4-dien-2-amine |
| SMILES | C=CC=NN(C)C(C)=CC=CC |
| InChI | InChI=1S/C10H16N2/c1-5-7-8-10(3)12(4)11-9-6-2/h5-9H,2H2,1,3-4H3 |
| InChIKey | XSFGHHZJIOGVSS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|