About (2-chlorothiophen-3-yl) acetate
(2-chlorothiophen-3-yl) acetate (PubChem CID 91026986) has the molecular formula C6H5ClO2S
and a molecular weight of 176.62 g/mol. Its IUPAC name is (2-chlorothiophen-3-yl) acetate.
Molecular Properties
| Compound Name | (2-chlorothiophen-3-yl) acetate |
| PubChem CID | 91026986 |
| Molecular Formula | C6H5ClO2S |
| Molecular Weight | 176.62 g/mol |
| Exact Mass | 175.97 |
| IUPAC Name | (2-chlorothiophen-3-yl) acetate |
| SMILES | CC(=O)Oc1ccsc1Cl |
| InChI | InChI=1S/C6H5ClO2S/c1-4(8)9-5-2-3-10-6(5)7/h2-3H,1H3 |
| InChIKey | XOCNDPIDNVZHHR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.62 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chlorothiophen-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorothiophen-3-yl) acetate?
The IUPAC name of (2-chlorothiophen-3-yl) acetate (CID 91026986) is (2-chlorothiophen-3-yl) acetate.
What is the SMILES notation for (2-chlorothiophen-3-yl) acetate?
The canonical SMILES for (2-chlorothiophen-3-yl) acetate is CC(=O)Oc1ccsc1Cl.
What is the InChIKey of (2-chlorothiophen-3-yl) acetate?
The InChIKey is XOCNDPIDNVZHHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO2S/c1-4(8)9-5-2-3-10-6(5)7/h2-3H,1H3.
What are the key properties of (2-chlorothiophen-3-yl) acetate?
(2-chlorothiophen-3-yl) acetate has a molecular weight of 176.62 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorothiophen-3-yl) acetate is sourced from PubChem (CID 91026986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).