About (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene
(4R,5R)-3-azido-4,5-dimethylnonadec-7-ene (PubChem CID 91027004) has the molecular formula C21H41N3
and a molecular weight of 335.58 g/mol. Its IUPAC name is (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene.
Molecular Properties
| Compound Name | (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene |
| PubChem CID | 91027004 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene |
| SMILES | CCCCCCCCCCCC=CC[C@@H](C)[C@@H](C)C(CC)N=[N+]=[N-] |
| InChI | InChI=1S/C21H41N3/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19(3)20(4)21(6-2)23-24-22/h16-17,19-21H,5-15,18H2,1-4H3/t19-,20-,21?/m1/s1 |
| InChIKey | WSGDXOZFDOVJEN-OSBQEZSISA-N |
| XLogP | 8.21 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene?
The IUPAC name of (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene (CID 91027004) is (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene.
What is the SMILES notation for (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene?
The canonical SMILES for (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene is CCCCCCCCCCCC=CC[C@@H](C)[C@@H](C)C(CC)N=[N+]=[N-].
What is the InChIKey of (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene?
The InChIKey is WSGDXOZFDOVJEN-OSBQEZSISA-N. The full InChI is InChI=1S/C21H41N3/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19(3)20(4)21(6-2)23-24-22/h16-17,19-21H,5-15,18H2,1-4H3/t19-,20-,21?/m1/s1.
What are the key properties of (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene?
(4R,5R)-3-azido-4,5-dimethylnonadec-7-ene has a molecular weight of 335.58 g/mol, XLogP of 8.21, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-3-azido-4,5-dimethylnonadec-7-ene is sourced from PubChem (CID 91027004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).