About ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole
ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole (PubChem CID 91027170) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole |
| PubChem CID | 91027170 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole |
| SMILES | CC.Cc1nc(C2CCNCC2)no1 |
| InChI | InChI=1S/C8H13N3O.C2H6/c1-6-10-8(11-12-6)7-2-4-9-5-3-7;1-2/h7,9H,2-5H2,1H3;1-2H3 |
| InChIKey | KTTRUNVWVJVAET-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole?
The IUPAC name of ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole (CID 91027170) is ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole.
What is the SMILES notation for ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole?
The canonical SMILES for ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole is CC.Cc1nc(C2CCNCC2)no1.
What is the InChIKey of ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole?
The InChIKey is KTTRUNVWVJVAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O.C2H6/c1-6-10-8(11-12-6)7-2-4-9-5-3-7;1-2/h7,9H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole?
ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole has a molecular weight of 197.28 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-3-piperidin-4-yl-1,2,4-oxadiazole is sourced from PubChem (CID 91027170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).