About N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine
N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine (PubChem CID 91027814) has the molecular formula C19H18FN3O2
and a molecular weight of 339.37 g/mol. Its IUPAC name is N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine.
Molecular Properties
| Compound Name | N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine |
| PubChem CID | 91027814 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine |
| SMILES | COc1cc2cc3c(Nc4cccc(F)c4)n(C)[nH]c-3c2cc1OC |
| InChI | InChI=1S/C19H18FN3O2/c1-23-19(21-13-6-4-5-12(20)9-13)15-7-11-8-16(24-2)17(25-3)10-14(11)18(15)22-23/h4-10,21-22H,1-3H3 |
| InChIKey | CVJWNWRWRWFXTL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine?
The IUPAC name of N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine (CID 91027814) is N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine.
What is the SMILES notation for N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine?
The canonical SMILES for N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine is COc1cc2cc3c(Nc4cccc(F)c4)n(C)[nH]c-3c2cc1OC.
What is the InChIKey of N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine?
The InChIKey is CVJWNWRWRWFXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN3O2/c1-23-19(21-13-6-4-5-12(20)9-13)15-7-11-8-16(24-2)17(25-3)10-14(11)18(15)22-23/h4-10,21-22H,1-3H3.
What are the key properties of N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine?
N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine has a molecular weight of 339.37 g/mol, XLogP of 4.51, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorophenyl)-6,7-dimethoxy-2-methyl-1H-indeno[1,2-c]pyrazol-3-amine is sourced from PubChem (CID 91027814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).