C27H41NO4 — CID 91027992
1-[5-tert-butyl-2-[hydroxy(methoxy)methyl]-1H-pyrrol-3-yl]-7-(4-hydroxyphenyl)-2,3,6-trimethyloctan-4-one (PubChem CID 91027992) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is 1-[5-tert-butyl-2-[hydroxy(methoxy)methyl]-1H-pyrrol-3-yl]-7-(4-hydroxyphenyl)-2,3,6-trimethyloctan-4-one.
| Compound Name | 1-[5-tert-butyl-2-[hydroxy(methoxy)methyl]-1H-pyrrol-3-yl]-7-(4-hydroxyphenyl)-2,3,6-trimethyloctan-4-one |
|---|---|
| PubChem CID | 91027992 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 1-[5-tert-butyl-2-[hydroxy(methoxy)methyl]-1H-pyrrol-3-yl]-7-(4-hydroxyphenyl)-2,3,6-trimethyloctan-4-one |
| SMILES | COC(O)c1[nH]c(C(C)(C)C)cc1CC(C)C(C)C(=O)CC(C)C(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H41NO4/c1-16(13-21-15-24(27(5,6)7)28-25(21)26(31)32-8)19(4)23(30)14-17(2)18(3)20-9-11-22(29)12-10-20/h9-12,15-19,26,28-29,31H,13-14H2,1-8H3 |
| InChIKey | HCYKNHJTMWUCJY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|