C12H10N3+ — CID 91028112
4-(2-methylphenyl)-3,7-diaza-8-azoniatricyclo[4.2.0.02,8]octa-2(8),3,5-triene (PubChem CID 91028112) has the molecular formula C12H10N3+ and a molecular weight of 196.23 g/mol. Its IUPAC name is 4-(2-methylphenyl)-3,7-diaza-8-azoniatricyclo[4.2.0.02,8]octa-2(8),3,5-triene.
| Compound Name | 4-(2-methylphenyl)-3,7-diaza-8-azoniatricyclo[4.2.0.02,8]octa-2(8),3,5-triene |
|---|---|
| PubChem CID | 91028112 |
| Molecular Formula | C12H10N3+ |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 4-(2-methylphenyl)-3,7-diaza-8-azoniatricyclo[4.2.0.02,8]octa-2(8),3,5-triene |
| SMILES | Cc1ccccc1C1=NC2=[N+]3NC(=C1)C23 |
| InChI | InChI=1S/C12H9N3/c1-7-4-2-3-5-8(7)9-6-10-11-12(13-9)15(11)14-10/h2-6,11H,1H3/p+1 |
| InChIKey | ZQQZOPRLSKABSU-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|