C16H10F6N2O5 — CID 91028642
1-nitro-2-[2,2,2-trifluoro-1-[2,2,2-trifluoro-1-(2-nitrophenyl)ethoxy]ethyl]benzene (PubChem CID 91028642) has the molecular formula C16H10F6N2O5 and a molecular weight of 424.25 g/mol. Its IUPAC name is 1-nitro-2-[2,2,2-trifluoro-1-[2,2,2-trifluoro-1-(2-nitrophenyl)ethoxy]ethyl]benzene.
| Compound Name | 1-nitro-2-[2,2,2-trifluoro-1-[2,2,2-trifluoro-1-(2-nitrophenyl)ethoxy]ethyl]benzene |
|---|---|
| PubChem CID | 91028642 |
| Molecular Formula | C16H10F6N2O5 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 1-nitro-2-[2,2,2-trifluoro-1-[2,2,2-trifluoro-1-(2-nitrophenyl)ethoxy]ethyl]benzene |
| SMILES | O=[N+]([O-])c1ccccc1C(OC(c1ccccc1[N+](=O)[O-])C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H10F6N2O5/c17-15(18,19)13(9-5-1-3-7-11(9)23(25)26)29-14(16(20,21)22)10-6-2-4-8-12(10)24(27)28/h1-8,13-14H |
| InChIKey | WNTHIQCIQNREJK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|