C17H17ClF2N2O3 — CID 9102880
2-(4-chloro-2-methoxy-5-methylanilino)-N-[2-(difluoromethoxy)phenyl]acetamide (PubChem CID 9102880) has the molecular formula C17H17ClF2N2O3 and a molecular weight of 370.78 g/mol. Its IUPAC name is 2-(4-chloro-2-methoxy-5-methylanilino)-N-[2-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(4-chloro-2-methoxy-5-methylanilino)-N-[2-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 9102880 |
| Molecular Formula | C17H17ClF2N2O3 |
| Molecular Weight | 370.78 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-(4-chloro-2-methoxy-5-methylanilino)-N-[2-(difluoromethoxy)phenyl]acetamide |
| SMILES | COc1cc(Cl)c(C)cc1NCC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H17ClF2N2O3/c1-10-7-13(15(24-2)8-11(10)18)21-9-16(23)22-12-5-3-4-6-14(12)25-17(19)20/h3-8,17,21H,9H2,1-2H3,(H,22,23) |
| InChIKey | UIBGROPUSGJKRK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |