C15H17NO6 — CID 91029094
6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy]-6-oxohexanoic acid (PubChem CID 91029094) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is 6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy]-6-oxohexanoic acid.
| Compound Name | 6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 91029094 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 6-[(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C15H17NO6/c17-10(18)3-1-2-4-11(19)22-16-14(20)12-8-5-6-9(7-8)13(12)15(16)21/h5-6,8-9,20-21H,1-4,7H2,(H,17,18) |
| InChIKey | SJPLVVHXJGAXGL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|