C19H38O3Si — CID 91029323
(10S)-11-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethylundecane-2,3-dione (PubChem CID 91029323) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is (10S)-11-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethylundecane-2,3-dione.
| Compound Name | (10S)-11-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethylundecane-2,3-dione |
|---|---|
| PubChem CID | 91029323 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (10S)-11-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethylundecane-2,3-dione |
| SMILES | CC(=O)C(=O)CCC(C)CCC[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O3Si/c1-15(12-13-18(21)17(3)20)10-9-11-16(2)14-22-23(7,8)19(4,5)6/h15-16H,9-14H2,1-8H3/t15?,16-/m0/s1 |
| InChIKey | NCAXKNVVZIAYFX-LYKKTTPLSA-N |
| XLogP | 5.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|