About 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide
5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide (PubChem CID 91030221) has the molecular formula C13H10N4O
and a molecular weight of 238.25 g/mol. Its IUPAC name is 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide |
| PubChem CID | 91030221 |
| Molecular Formula | C13H10N4O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(-c2cnc3[nH]ccc3c2)cn1 |
| InChI | InChI=1S/C13H10N4O/c14-12(18)11-2-1-9(6-16-11)10-5-8-3-4-15-13(8)17-7-10/h1-7H,(H2,14,18)(H,15,17) |
| InChIKey | XKUGHAYDPSCLDN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide?
The IUPAC name of 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide (CID 91030221) is 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide.
What is the SMILES notation for 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide?
The canonical SMILES for 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide is NC(=O)c1ccc(-c2cnc3[nH]ccc3c2)cn1.
What is the InChIKey of 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide?
The InChIKey is XKUGHAYDPSCLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O/c14-12(18)11-2-1-9(6-16-11)10-5-8-3-4-15-13(8)17-7-10/h1-7H,(H2,14,18)(H,15,17).
What are the key properties of 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide?
5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide has a molecular weight of 238.25 g/mol, XLogP of 1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyridine-2-carboxamide is sourced from PubChem (CID 91030221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).