C20H38F6N6O3S2 — CID 91030614
N'-[2-(2-amino-2-methylpropyl)sulfanylethyl]ethanimidamide;N'-[2-(2-amino-2-methylpropyl)sulfinylethyl]ethanimidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 91030614) has the molecular formula C20H38F6N6O3S2 and a molecular weight of 588.69 g/mol. Its IUPAC name is N'-[2-(2-amino-2-methylpropyl)sulfanylethyl]ethanimidamide;N'-[2-(2-amino-2-methylpropyl)sulfinylethyl]ethanimidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N'-[2-(2-amino-2-methylpropyl)sulfanylethyl]ethanimidamide;N'-[2-(2-amino-2-methylpropyl)sulfinylethyl]ethanimidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 91030614 |
| Molecular Formula | C20H38F6N6O3S2 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | N'-[2-(2-amino-2-methylpropyl)sulfanylethyl]ethanimidamide;N'-[2-(2-amino-2-methylpropyl)sulfinylethyl]ethanimidamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | C/C(N)=N\CCS(=O)CC(C)(C)N.C/C(N)=N\CCSCC(C)(C)N.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H19N3OS.C8H19N3S.C4F6O2/c1-7(9)11-4-5-13(12)6-8(2,3)10;1-7(9)11-4-5-12-6-8(2,3)10;5-3(6,7)1(11)2(12)4(8,9)10/h4-6,10H2,1-3H3,(H2,9,11);4-6,10H2,1-3H3,(H2,9,11); |
| InChIKey | WJCAHHZUGPCEMV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 180.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|