C15H25F — CID 91030681
(1Z)-1-fluoro-3,7,11-trimethyldodeca-1,6,10-triene (PubChem CID 91030681) has the molecular formula C15H25F and a molecular weight of 224.36 g/mol. Its IUPAC name is (1Z)-1-fluoro-3,7,11-trimethyldodeca-1,6,10-triene.
| Compound Name | (1Z)-1-fluoro-3,7,11-trimethyldodeca-1,6,10-triene |
|---|---|
| PubChem CID | 91030681 |
| Molecular Formula | C15H25F |
| Molecular Weight | 224.36 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (1Z)-1-fluoro-3,7,11-trimethyldodeca-1,6,10-triene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)/C=C\F |
| InChI | InChI=1S/C15H25F/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12,15H,5-6,8,10H2,1-4H3/b12-11-,14-9? |
| InChIKey | YWZZRUHNIGJMJY-OKBTWZQFSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.36 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|