C12H8O6 — CID 91030886
3,8-dioxatetracyclo[8.2.2.01,5.06,10]tetradec-5-ene-2,4,7,9-tetrone (PubChem CID 91030886) has the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. Its IUPAC name is 3,8-dioxatetracyclo[8.2.2.01,5.06,10]tetradec-5-ene-2,4,7,9-tetrone.
| Compound Name | 3,8-dioxatetracyclo[8.2.2.01,5.06,10]tetradec-5-ene-2,4,7,9-tetrone |
|---|---|
| PubChem CID | 91030886 |
| Molecular Formula | C12H8O6 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 3,8-dioxatetracyclo[8.2.2.01,5.06,10]tetradec-5-ene-2,4,7,9-tetrone |
| SMILES | O=C1OC(=O)C23CCC4(CC2)C(=O)OC(=O)C4=C13 |
| InChI | InChI=1S/C12H8O6/c13-7-5-6-8(14)18-10(16)12(6)2-1-11(5,3-4-12)9(15)17-7/h1-4H2 |
| InChIKey | ZFYKDKZVUZEMQY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|