C24H32FN3O5 — CID 91031001
2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3,4,7-tetrol (PubChem CID 91031001) has the molecular formula C24H32FN3O5 and a molecular weight of 461.53 g/mol. Its IUPAC name is 2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3,4,7-tetrol.
| Compound Name | 2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3,4,7-tetrol |
|---|---|
| PubChem CID | 91031001 |
| Molecular Formula | C24H32FN3O5 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3,4,7-tetrol |
| SMILES | CC(C)Oc1ccc(F)cc1N1CCN(CCCn2c(O)c3c(c2O)C(O)C=CC3O)CC1 |
| InChI | InChI=1S/C24H32FN3O5/c1-15(2)33-20-7-4-16(25)14-17(20)27-12-10-26(11-13-27)8-3-9-28-23(31)21-18(29)5-6-19(30)22(21)24(28)32/h4-7,14-15,18-19,29-32H,3,8-13H2,1-2H3 |
| InChIKey | CQNZEQIWFAROAC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|