About (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one
(2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one (PubChem CID 91031156) has the molecular formula C6H12O4S
and a molecular weight of 180.22 g/mol. Its IUPAC name is (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one.
Molecular Properties
| Compound Name | (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one |
| PubChem CID | 91031156 |
| Molecular Formula | C6H12O4S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one |
| SMILES | CC(S)C(O)C(=O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O4S/c1-3(11)5(9)6(10)4(8)2-7/h3-5,7-9,11H,2H2,1H3/t3?,4-,5?/m1/s1 |
| InChIKey | ZPBMAOWYSMTURH-ACHVEOLNSA-N |
| XLogP | -1.41 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one?
The IUPAC name of (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one (CID 91031156) is (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one.
What is the SMILES notation for (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one?
The canonical SMILES for (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one is CC(S)C(O)C(=O)[C@H](O)CO.
What is the InChIKey of (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one?
The InChIKey is ZPBMAOWYSMTURH-ACHVEOLNSA-N. The full InChI is InChI=1S/C6H12O4S/c1-3(11)5(9)6(10)4(8)2-7/h3-5,7-9,11H,2H2,1H3/t3?,4-,5?/m1/s1.
What are the key properties of (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one?
(2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one has a molecular weight of 180.22 g/mol, XLogP of -1.41, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,2,4-trihydroxy-5-sulfanylhexan-3-one is sourced from PubChem (CID 91031156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).