C21H18ClF3N2O — CID 91031894
3-[3-(3-chlorophenyl)phenyl]-3-cyclopropyl-5-imino-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one (PubChem CID 91031894) has the molecular formula C21H18ClF3N2O and a molecular weight of 406.84 g/mol. Its IUPAC name is 3-[3-(3-chlorophenyl)phenyl]-3-cyclopropyl-5-imino-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one.
| Compound Name | 3-[3-(3-chlorophenyl)phenyl]-3-cyclopropyl-5-imino-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 91031894 |
| Molecular Formula | C21H18ClF3N2O |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 3-[3-(3-chlorophenyl)phenyl]-3-cyclopropyl-5-imino-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
| SMILES | [H]/N=C1\CC(c2cccc(-c3cccc(Cl)c3)c2)(C2CC2)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C21H18ClF3N2O/c22-17-6-2-4-14(10-17)13-3-1-5-16(9-13)20(15-7-8-15)11-18(26)27(19(20)28)12-21(23,24)25/h1-6,9-10,15,26H,7-8,11-12H2/b26-18+ |
| InChIKey | PRTYMXGOOVXUNT-NLRVBDNBSA-N |
| XLogP | 5.43 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|