C38H59N7O2 — CID 91032627
[(2R)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butyl] N-octadeca-9,12-dienylcarbamate (PubChem CID 91032627) has the molecular formula C38H59N7O2 and a molecular weight of 645.94 g/mol. Its IUPAC name is [(2R)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butyl] N-octadeca-9,12-dienylcarbamate.
| Compound Name | [(2R)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butyl] N-octadeca-9,12-dienylcarbamate |
|---|---|
| PubChem CID | 91032627 |
| Molecular Formula | C38H59N7O2 |
| Molecular Weight | 645.94 g/mol |
| Exact Mass | 645.47 |
| IUPAC Name | [(2R)-2-[[6-(benzylamino)-9-propan-2-ylpurin-2-yl]amino]butyl] N-octadeca-9,12-dienylcarbamate |
| SMILES | CCCCCC=CCC=CCCCCCCCCNC(=O)OC[C@@H](CC)Nc1nc(NCc2ccccc2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C38H59N7O2/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-27-39-38(46)47-29-33(6-2)42-37-43-35(40-28-32-25-22-21-23-26-32)34-36(44-37)45(30-41-34)31(3)4/h10-11,13-14,21-23,25-26,30-31,33H,5-9,12,15-20,24,27-29H2,1-4H3,(H,39,46)(H2,40,42,43,44)/t33-/m1/s1 |
| InChIKey | LGXBJGZGRHXIHA-MGBGTMOVSA-N |
| XLogP | 9.75 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.94 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|