About methylperoxysulfanylethane;naphthalen-2-amine;propane
methylperoxysulfanylethane;naphthalen-2-amine;propane (PubChem CID 91032698) has the molecular formula C16H25NO2S
and a molecular weight of 295.45 g/mol. Its IUPAC name is methylperoxysulfanylethane;naphthalen-2-amine;propane.
Molecular Properties
| Compound Name | methylperoxysulfanylethane;naphthalen-2-amine;propane |
| PubChem CID | 91032698 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | methylperoxysulfanylethane;naphthalen-2-amine;propane |
| SMILES | CCC.CCSOOC.Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9N.C3H8O2S.C3H8/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-3-6-5-4-2;1-3-2/h1-7H,11H2;3H2,1-2H3;3H2,1-2H3 |
| InChIKey | ASJJZZORBUTWJL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylperoxysulfanylethane;naphthalen-2-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylperoxysulfanylethane;naphthalen-2-amine;propane?
The IUPAC name of methylperoxysulfanylethane;naphthalen-2-amine;propane (CID 91032698) is methylperoxysulfanylethane;naphthalen-2-amine;propane.
What is the SMILES notation for methylperoxysulfanylethane;naphthalen-2-amine;propane?
The canonical SMILES for methylperoxysulfanylethane;naphthalen-2-amine;propane is CCC.CCSOOC.Nc1ccc2ccccc2c1.
What is the InChIKey of methylperoxysulfanylethane;naphthalen-2-amine;propane?
The InChIKey is ASJJZZORBUTWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C3H8O2S.C3H8/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-3-6-5-4-2;1-3-2/h1-7H,11H2;3H2,1-2H3;3H2,1-2H3.
What are the key properties of methylperoxysulfanylethane;naphthalen-2-amine;propane?
methylperoxysulfanylethane;naphthalen-2-amine;propane has a molecular weight of 295.45 g/mol, XLogP of 5.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylperoxysulfanylethane;naphthalen-2-amine;propane is sourced from PubChem (CID 91032698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).