C8H14N4O6 — CID 91032840
2-azido-N-[(2R,3R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 91032840) has the molecular formula C8H14N4O6 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2-azido-N-[(2R,3R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | 2-azido-N-[(2R,3R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 91032840 |
| Molecular Formula | C8H14N4O6 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-azido-N-[(2R,3R,5S)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | [N-]=[N+]=NCC(=O)N[C@@H]1C(O)[C@H](O)C(CO)O[C@H]1O |
| InChI | InChI=1S/C8H14N4O6/c9-12-10-1-4(14)11-5-7(16)6(15)3(2-13)18-8(5)17/h3,5-8,13,15-17H,1-2H2,(H,11,14)/t3?,5-,6-,7?,8-/m1/s1 |
| InChIKey | AFNOHTDETQTADW-BNFGCYOQSA-N |
| XLogP | -2.79 |
| TPSA | 168.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|